C8H9BrN4 — CID 84629932
(4-bromo-6-methyl-1H-benzimidazol-2-yl)hydrazine (PubChem CID 84629932) has the molecular formula C8H9BrN4 and a molecular weight of 241.09 g/mol. Its IUPAC name is (4-bromo-6-methyl-1H-benzimidazol-2-yl)hydrazine.
| Compound Name | (4-bromo-6-methyl-1H-benzimidazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 84629932 |
| Molecular Formula | C8H9BrN4 |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | (4-bromo-6-methyl-1H-benzimidazol-2-yl)hydrazine |
| SMILES | Cc1cc(Br)c2nc(NN)[nH]c2c1 |
| InChI | InChI=1S/C8H9BrN4/c1-4-2-5(9)7-6(3-4)11-8(12-7)13-10/h2-3H,10H2,1H3,(H2,11,12,13) |
| InChIKey | UNTBGNJOPGXBBW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|