C8H8BrN3O — CID 82231953
(7-bromo-5-methyl-1,3-benzoxazol-2-yl)hydrazine (PubChem CID 82231953) has the molecular formula C8H8BrN3O and a molecular weight of 242.08 g/mol. Its IUPAC name is (7-bromo-5-methyl-1,3-benzoxazol-2-yl)hydrazine.
| Compound Name | (7-bromo-5-methyl-1,3-benzoxazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 82231953 |
| Molecular Formula | C8H8BrN3O |
| Molecular Weight | 242.08 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | (7-bromo-5-methyl-1,3-benzoxazol-2-yl)hydrazine |
| SMILES | Cc1cc(Br)c2oc(NN)nc2c1 |
| InChI | InChI=1S/C8H8BrN3O/c1-4-2-5(9)7-6(3-4)11-8(12-10)13-7/h2-3H,10H2,1H3,(H,11,12) |
| InChIKey | YDHIJVLZTAOVNH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.08 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|