C10H9BrN2O2 — CID 82233431
1-[7-bromo-2-(methylamino)-1,3-benzoxazol-5-yl]ethanone (PubChem CID 82233431) has the molecular formula C10H9BrN2O2 and a molecular weight of 269.10 g/mol. Its IUPAC name is 1-[7-bromo-2-(methylamino)-1,3-benzoxazol-5-yl]ethanone.
| Compound Name | 1-[7-bromo-2-(methylamino)-1,3-benzoxazol-5-yl]ethanone |
|---|---|
| PubChem CID | 82233431 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 1-[7-bromo-2-(methylamino)-1,3-benzoxazol-5-yl]ethanone |
| SMILES | CNc1nc2cc(C(C)=O)cc(Br)c2o1 |
| InChI | InChI=1S/C10H9BrN2O2/c1-5(14)6-3-7(11)9-8(4-6)13-10(12-2)15-9/h3-4H,1-2H3,(H,12,13) |
| InChIKey | QFUFOBCZSRQCOJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |