C11H14BrNOSi — CID 178038912
(7-bromo-5-methylfuro[3,2-b]pyridin-2-yl)-trimethylsilane (PubChem CID 178038912) has the molecular formula C11H14BrNOSi and a molecular weight of 284.23 g/mol. Its IUPAC name is (7-bromo-5-methylfuro[3,2-b]pyridin-2-yl)-trimethylsilane.
| Compound Name | (7-bromo-5-methylfuro[3,2-b]pyridin-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 178038912 |
| Molecular Formula | C11H14BrNOSi |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | (7-bromo-5-methylfuro[3,2-b]pyridin-2-yl)-trimethylsilane |
| SMILES | Cc1cc(Br)c2oc([Si](C)(C)C)cc2n1 |
| InChI | InChI=1S/C11H14BrNOSi/c1-7-5-8(12)11-9(13-7)6-10(14-11)15(2,3)4/h5-6H,1-4H3 |
| InChIKey | XZNYHQVLTWEOCR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|