C8H5BrF3N3O — CID 82233963
[7-bromo-5-(trifluoromethyl)-1,3-benzoxazol-2-yl]hydrazine (PubChem CID 82233963) has the molecular formula C8H5BrF3N3O and a molecular weight of 296.05 g/mol. Its IUPAC name is [7-bromo-5-(trifluoromethyl)-1,3-benzoxazol-2-yl]hydrazine.
| Compound Name | [7-bromo-5-(trifluoromethyl)-1,3-benzoxazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 82233963 |
| Molecular Formula | C8H5BrF3N3O |
| Molecular Weight | 296.05 g/mol |
| Exact Mass | 294.96 |
| IUPAC Name | [7-bromo-5-(trifluoromethyl)-1,3-benzoxazol-2-yl]hydrazine |
| SMILES | NNc1nc2cc(C(F)(F)F)cc(Br)c2o1 |
| InChI | InChI=1S/C8H5BrF3N3O/c9-4-1-3(8(10,11)12)2-5-6(4)16-7(14-5)15-13/h1-2H,13H2,(H,14,15) |
| InChIKey | WOYCHHXUUGLBKO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.05 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|