C8H6F3N3O — CID 115059690
[4-(trifluoromethyl)-1,3-benzoxazol-2-yl]hydrazine (PubChem CID 115059690) has the molecular formula C8H6F3N3O and a molecular weight of 217.15 g/mol. Its IUPAC name is [4-(trifluoromethyl)-1,3-benzoxazol-2-yl]hydrazine.
| Compound Name | [4-(trifluoromethyl)-1,3-benzoxazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 115059690 |
| Molecular Formula | C8H6F3N3O |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | [4-(trifluoromethyl)-1,3-benzoxazol-2-yl]hydrazine |
| SMILES | NNc1nc2c(C(F)(F)F)cccc2o1 |
| InChI | InChI=1S/C8H6F3N3O/c9-8(10,11)4-2-1-3-5-6(4)13-7(14-12)15-5/h1-3H,12H2,(H,13,14) |
| InChIKey | RYLIKTXAFGEKKE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|