C14H21N3O2 — CID 79893328
1-[(4-amino-1,3-benzoxazol-2-yl)amino]-2,4-dimethylpentan-2-ol (PubChem CID 79893328) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[(4-amino-1,3-benzoxazol-2-yl)amino]-2,4-dimethylpentan-2-ol.
| Compound Name | 1-[(4-amino-1,3-benzoxazol-2-yl)amino]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 79893328 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-[(4-amino-1,3-benzoxazol-2-yl)amino]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)CC(C)(O)CNc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C14H21N3O2/c1-9(2)7-14(3,18)8-16-13-17-12-10(15)5-4-6-11(12)19-13/h4-6,9,18H,7-8,15H2,1-3H3,(H,16,17) |
| InChIKey | HANLRMKZINDJSV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|