C13H13N3O2S — CID 106434509
2-[(4-amino-1,3-benzoxazol-2-yl)amino]-1-thiophen-3-ylethanol (PubChem CID 106434509) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 106434509 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]-1-thiophen-3-ylethanol |
| SMILES | Nc1cccc2oc(NCC(O)c3ccsc3)nc12 |
| InChI | InChI=1S/C13H13N3O2S/c14-9-2-1-3-11-12(9)16-13(18-11)15-6-10(17)8-4-5-19-7-8/h1-5,7,10,17H,6,14H2,(H,15,16) |
| InChIKey | HKWPANCCMXTWOW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|