C13H17BrN2 — CID 84642831
1-(3-bromo-1,7-dimethylindol-2-yl)-N-methylethanamine (PubChem CID 84642831) has the molecular formula C13H17BrN2 and a molecular weight of 281.20 g/mol. Its IUPAC name is 1-(3-bromo-1,7-dimethylindol-2-yl)-N-methylethanamine.
| Compound Name | 1-(3-bromo-1,7-dimethylindol-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 84642831 |
| Molecular Formula | C13H17BrN2 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1-(3-bromo-1,7-dimethylindol-2-yl)-N-methylethanamine |
| SMILES | CNC(C)c1c(Br)c2cccc(C)c2n1C |
| InChI | InChI=1S/C13H17BrN2/c1-8-6-5-7-10-11(14)13(9(2)15-3)16(4)12(8)10/h5-7,9,15H,1-4H3 |
| InChIKey | RMJRLYYXCQZVDI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |