C13H17BrN2O2 — CID 84645479
tert-butyl 7-bromo-3,4-dihydro-2H-quinoxaline-1-carboxylate (PubChem CID 84645479) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is tert-butyl 7-bromo-3,4-dihydro-2H-quinoxaline-1-carboxylate.
| Compound Name | tert-butyl 7-bromo-3,4-dihydro-2H-quinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 84645479 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | tert-butyl 7-bromo-3,4-dihydro-2H-quinoxaline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H17BrN2O2/c1-13(2,3)18-12(17)16-7-6-15-10-5-4-9(14)8-11(10)16/h4-5,8,15H,6-7H2,1-3H3 |
| InChIKey | IAFNDCQGIBCFLA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |