4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid

C15H13BrN2O2 — CID 117030520

IUPAC4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid
SMILESO=C(O)c1ccc(N2CCNc3ccc(Br)cc32)cc1
InChIInChI=1S/C15H13BrN2O2/c16-11-3-6-13-14(9-11)18(8-7-17-13)12-4-1-10(2-5-12)15(19)20/h1-6,9,17H,7-8H2,(H,19,20)
InChIKeyWAOUDFQJMRIUSQ-UHFFFAOYSA-N
MW333.19 g/mol
LogP3.71
Rot. Bonds2

About 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid

4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid (PubChem CID 117030520) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid.

Molecular Properties

Compound Name4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid
PubChem CID117030520
Molecular FormulaC15H13BrN2O2
Molecular Weight333.19 g/mol
Exact Mass332.02
IUPAC Name4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid
SMILESO=C(O)c1ccc(N2CCNc3ccc(Br)cc32)cc1
InChIInChI=1S/C15H13BrN2O2/c16-11-3-6-13-14(9-11)18(8-7-17-13)12-4-1-10(2-5-12)15(19)20/h1-6,9,17H,7-8H2,(H,19,20)
InChIKeyWAOUDFQJMRIUSQ-UHFFFAOYSA-N
XLogP3.71
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.19
LogP ≤ 53.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid?
The IUPAC name of 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid (CID 117030520) is 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid.
What is the SMILES notation for 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid?
The canonical SMILES for 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid is O=C(O)c1ccc(N2CCNc3ccc(Br)cc32)cc1.
What is the InChIKey of 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid?
The InChIKey is WAOUDFQJMRIUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrN2O2/c16-11-3-6-13-14(9-11)18(8-7-17-13)12-4-1-10(2-5-12)15(19)20/h1-6,9,17H,7-8H2,(H,19,20).
What are the key properties of 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid?
4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid has a molecular weight of 333.19 g/mol, XLogP of 3.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-bromo-3,4-dihydro-2H-quinoxalin-1-yl)benzoic acid is sourced from PubChem (CID 117030520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).