C15H15BrN2 — CID 117006928
7-bromo-4-(3-methylphenyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 117006928) has the molecular formula C15H15BrN2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 7-bromo-4-(3-methylphenyl)-2,3-dihydro-1H-quinoxaline.
| Compound Name | 7-bromo-4-(3-methylphenyl)-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 117006928 |
| Molecular Formula | C15H15BrN2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 7-bromo-4-(3-methylphenyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | Cc1cccc(N2CCNc3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C15H15BrN2/c1-11-3-2-4-13(9-11)18-8-7-17-14-10-12(16)5-6-15(14)18/h2-6,9-10,17H,7-8H2,1H3 |
| InChIKey | AYOOCZGCAPQPJI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |