C16H17BrN2 — CID 117006931
7-bromo-4-(2,5-dimethylphenyl)-2,3-dihydro-1H-quinoxaline (PubChem CID 117006931) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 7-bromo-4-(2,5-dimethylphenyl)-2,3-dihydro-1H-quinoxaline.
| Compound Name | 7-bromo-4-(2,5-dimethylphenyl)-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 117006931 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 7-bromo-4-(2,5-dimethylphenyl)-2,3-dihydro-1H-quinoxaline |
| SMILES | Cc1ccc(C)c(N2CCNc3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C16H17BrN2/c1-11-3-4-12(2)16(9-11)19-8-7-18-14-10-13(17)5-6-15(14)19/h3-6,9-10,18H,7-8H2,1-2H3 |
| InChIKey | ZZDCUAXMDCFOFB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |