About 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline
3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline (PubChem CID 117031105) has the molecular formula C15H16BrN3
and a molecular weight of 318.22 g/mol. Its IUPAC name is 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline.
Molecular Properties
| Compound Name | 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline |
| PubChem CID | 117031105 |
| Molecular Formula | C15H16BrN3 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline |
| SMILES | CNc1cccc(N2CCNc3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C15H16BrN3/c1-17-12-3-2-4-13(10-12)19-8-7-18-14-9-11(16)5-6-15(14)19/h2-6,9-10,17-18H,7-8H2,1H3 |
| InChIKey | HNRHMMDAGZEAAK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline?
The IUPAC name of 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline (CID 117031105) is 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline.
What is the SMILES notation for 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline?
The canonical SMILES for 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline is CNc1cccc(N2CCNc3cc(Br)ccc32)c1.
What is the InChIKey of 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline?
The InChIKey is HNRHMMDAGZEAAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrN3/c1-17-12-3-2-4-13(10-12)19-8-7-18-14-9-11(16)5-6-15(14)19/h2-6,9-10,17-18H,7-8H2,1H3.
What are the key properties of 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline?
3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline has a molecular weight of 318.22 g/mol, XLogP of 4.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline is sourced from PubChem (CID 117031105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).