C15H16BrN3 — CID 117031105
3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline (PubChem CID 117031105) has the molecular formula C15H16BrN3 and a molecular weight of 318.22 g/mol. Its IUPAC name is 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline.
| Compound Name | 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline |
|---|---|
| PubChem CID | 117031105 |
| Molecular Formula | C15H16BrN3 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-(6-bromo-3,4-dihydro-2H-quinoxalin-1-yl)-N-methylaniline |
| SMILES | CNc1cccc(N2CCNc3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C15H16BrN3/c1-17-12-3-2-4-13(10-12)19-8-7-18-14-9-11(16)5-6-15(14)19/h2-6,9-10,17-18H,7-8H2,1H3 |
| InChIKey | HNRHMMDAGZEAAK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |