C14H17BrN2O3 — CID 84646705
2-amino-3-(2-bromo-7-methoxy-1,4-dimethylindol-3-yl)propanoic acid (PubChem CID 84646705) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is 2-amino-3-(2-bromo-7-methoxy-1,4-dimethylindol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(2-bromo-7-methoxy-1,4-dimethylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 84646705 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-amino-3-(2-bromo-7-methoxy-1,4-dimethylindol-3-yl)propanoic acid |
| SMILES | COc1ccc(C)c2c(CC(N)C(=O)O)c(Br)n(C)c12 |
| InChI | InChI=1S/C14H17BrN2O3/c1-7-4-5-10(20-3)12-11(7)8(13(15)17(12)2)6-9(16)14(18)19/h4-5,9H,6,16H2,1-3H3,(H,18,19) |
| InChIKey | GOPJAJYBUOATMU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |