C5H11F2NO — CID 84648386
2-(3,3-difluoropropoxy)ethanamine (PubChem CID 84648386) has the molecular formula C5H11F2NO and a molecular weight of 139.15 g/mol. Its IUPAC name is 2-(3,3-difluoropropoxy)ethanamine.
| Compound Name | 2-(3,3-difluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 84648386 |
| Molecular Formula | C5H11F2NO |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 2-(3,3-difluoropropoxy)ethanamine |
| SMILES | NCCOCCC(F)F |
| InChI | InChI=1S/C5H11F2NO/c6-5(7)1-3-9-4-2-8/h5H,1-4,8H2 |
| InChIKey | NSPVSGKBFKGYPF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|