About 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile
2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile (PubChem CID 84651424) has the molecular formula C8H6N2S
and a molecular weight of 162.22 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile.
Analyze 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile?
The IUPAC name of 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile (CID 84651424) is 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile.
What is the SMILES notation for 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile?
The canonical SMILES for 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile is N#Cc1cncc2c1SCC2.
What is the InChIKey of 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile?
The InChIKey is VOYRNEOGSWPCPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2S/c9-3-7-5-10-4-6-1-2-11-8(6)7/h4-5H,1-2H2.
What are the key properties of 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile?
2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile has a molecular weight of 162.22 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothieno[3,2-c]pyridine-7-carbonitrile is sourced from PubChem (CID 84651424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).