C8H11N3O — CID 84652110
2-pyrrolidin-3-yl-1H-pyrimidin-6-one (PubChem CID 84652110) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-pyrrolidin-3-yl-1H-pyrimidin-6-one.
| Compound Name | 2-pyrrolidin-3-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 84652110 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2-pyrrolidin-3-yl-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(C2CCNC2)[nH]1 |
| InChI | InChI=1S/C8H11N3O/c12-7-2-4-10-8(11-7)6-1-3-9-5-6/h2,4,6,9H,1,3,5H2,(H,10,11,12) |
| InChIKey | FXWBKNAHDBMFOD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |