C10H21NO — CID 84654170
(3,3-diethylpiperidin-4-yl)methanol (PubChem CID 84654170) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (3,3-diethylpiperidin-4-yl)methanol.
| Compound Name | (3,3-diethylpiperidin-4-yl)methanol |
|---|---|
| PubChem CID | 84654170 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (3,3-diethylpiperidin-4-yl)methanol |
| SMILES | CCC1(CC)CNCCC1CO |
| InChI | InChI=1S/C10H21NO/c1-3-10(4-2)8-11-6-5-9(10)7-12/h9,11-12H,3-8H2,1-2H3 |
| InChIKey | XPZZUENAOIUNLX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |