C13H31BNNaO — CID 173274900
sodium;boranuide;3,3-dibutylpiperidin-4-ol (PubChem CID 173274900) has the molecular formula C13H31BNNaO and a molecular weight of 251.20 g/mol. Its IUPAC name is sodium;boranuide;3,3-dibutylpiperidin-4-ol.
| Compound Name | sodium;boranuide;3,3-dibutylpiperidin-4-ol |
|---|---|
| PubChem CID | 173274900 |
| Molecular Formula | C13H31BNNaO |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | sodium;boranuide;3,3-dibutylpiperidin-4-ol |
| SMILES | CCCCC1(CCCC)CNCCC1O.[BH4-].[Na+] |
| InChI | InChI=1S/C13H27NO.BH4.Na/c1-3-5-8-13(9-6-4-2)11-14-10-7-12(13)15;;/h12,14-15H,3-11H2,1-2H3;1H4;/q;-1;+1 |
| InChIKey | DOXODFNXFACWBW-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|