C14H31N2+ — CID 67229366
2,2-dibutyl-1,1-dimethylpiperazin-1-ium (PubChem CID 67229366) has the molecular formula C14H31N2+ and a molecular weight of 227.42 g/mol. Its IUPAC name is 2,2-dibutyl-1,1-dimethylpiperazin-1-ium.
| Compound Name | 2,2-dibutyl-1,1-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 67229366 |
| Molecular Formula | C14H31N2+ |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.25 |
| IUPAC Name | 2,2-dibutyl-1,1-dimethylpiperazin-1-ium |
| SMILES | CCCCC1(CCCC)CNCC[N+]1(C)C |
| InChI | InChI=1S/C14H31N2/c1-5-7-9-14(10-8-6-2)13-15-11-12-16(14,3)4/h15H,5-13H2,1-4H3/q+1 |
| InChIKey | JGVDVNVJYFRIHH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|