C7H14N2OS — CID 84654989
N-(azetidin-2-ylmethyl)-2-methylsulfanylacetamide (PubChem CID 84654989) has the molecular formula C7H14N2OS and a molecular weight of 174.27 g/mol. Its IUPAC name is N-(azetidin-2-ylmethyl)-2-methylsulfanylacetamide.
| Compound Name | N-(azetidin-2-ylmethyl)-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 84654989 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | N-(azetidin-2-ylmethyl)-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)NCC1CCN1 |
| InChI | InChI=1S/C7H14N2OS/c1-11-5-7(10)9-4-6-2-3-8-6/h6,8H,2-5H2,1H3,(H,9,10) |
| InChIKey | GMTBHBYMNKRIDR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |