About 3-(3-aminophenyl)-2H-1,2-oxazol-5-one
3-(3-aminophenyl)-2H-1,2-oxazol-5-one (PubChem CID 84655473) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-(3-aminophenyl)-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-(3-aminophenyl)-2H-1,2-oxazol-5-one |
| PubChem CID | 84655473 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-(3-aminophenyl)-2H-1,2-oxazol-5-one |
| SMILES | Nc1cccc(-c2cc(=O)o[nH]2)c1 |
| InChI | InChI=1S/C9H8N2O2/c10-7-3-1-2-6(4-7)8-5-9(12)13-11-8/h1-5,11H,10H2 |
| InChIKey | TXTVSDGPFQUMSM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-aminophenyl)-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminophenyl)-2H-1,2-oxazol-5-one?
The IUPAC name of 3-(3-aminophenyl)-2H-1,2-oxazol-5-one (CID 84655473) is 3-(3-aminophenyl)-2H-1,2-oxazol-5-one.
What is the SMILES notation for 3-(3-aminophenyl)-2H-1,2-oxazol-5-one?
The canonical SMILES for 3-(3-aminophenyl)-2H-1,2-oxazol-5-one is Nc1cccc(-c2cc(=O)o[nH]2)c1.
What is the InChIKey of 3-(3-aminophenyl)-2H-1,2-oxazol-5-one?
The InChIKey is TXTVSDGPFQUMSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c10-7-3-1-2-6(4-7)8-5-9(12)13-11-8/h1-5,11H,10H2.
What are the key properties of 3-(3-aminophenyl)-2H-1,2-oxazol-5-one?
3-(3-aminophenyl)-2H-1,2-oxazol-5-one has a molecular weight of 176.17 g/mol, XLogP of 1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminophenyl)-2H-1,2-oxazol-5-one is sourced from PubChem (CID 84655473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).