C9H14N2O2 — CID 84658523
(2,6-dimethoxy-4-methyl-3-pyridinyl)methanamine (PubChem CID 84658523) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2,6-dimethoxy-4-methyl-3-pyridinyl)methanamine.
| Compound Name | (2,6-dimethoxy-4-methyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 84658523 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (2,6-dimethoxy-4-methyl-3-pyridinyl)methanamine |
| SMILES | COc1cc(C)c(CN)c(OC)n1 |
| InChI | InChI=1S/C9H14N2O2/c1-6-4-8(12-2)11-9(13-3)7(6)5-10/h4H,5,10H2,1-3H3 |
| InChIKey | OOCZPJQEHMDYOV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |