C9H6N4O — CID 84660464
4-hydroxy-2-(1,2,4-triazol-4-yl)benzonitrile (PubChem CID 84660464) has the molecular formula C9H6N4O and a molecular weight of 186.17 g/mol. Its IUPAC name is 4-hydroxy-2-(1,2,4-triazol-4-yl)benzonitrile.
| Compound Name | 4-hydroxy-2-(1,2,4-triazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 84660464 |
| Molecular Formula | C9H6N4O |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 4-hydroxy-2-(1,2,4-triazol-4-yl)benzonitrile |
| SMILES | N#Cc1ccc(O)cc1-n1cnnc1 |
| InChI | InChI=1S/C9H6N4O/c10-4-7-1-2-8(14)3-9(7)13-5-11-12-6-13/h1-3,5-6,14H |
| InChIKey | FJCGJMCVCONZAY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |