About 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile
6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 131539726) has the molecular formula C8H5N3O
and a molecular weight of 159.15 g/mol. Its IUPAC name is 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile |
| PubChem CID | 131539726 |
| Molecular Formula | C8H5N3O |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | N#Cc1cnn2cc(O)ccc12 |
| InChI | InChI=1S/C8H5N3O/c9-3-6-4-10-11-5-7(12)1-2-8(6)11/h1-2,4-5,12H |
| InChIKey | PXOYBAFFEAADOV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile?
The IUPAC name of 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile (CID 131539726) is 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile.
What is the SMILES notation for 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile?
The canonical SMILES for 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile is N#Cc1cnn2cc(O)ccc12.
What is the InChIKey of 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile?
The InChIKey is PXOYBAFFEAADOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O/c9-3-6-4-10-11-5-7(12)1-2-8(6)11/h1-2,4-5,12H.
What are the key properties of 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile?
6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile has a molecular weight of 159.15 g/mol, XLogP of 0.91, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxypyrazolo[1,5-a]pyridine-3-carbonitrile is sourced from PubChem (CID 131539726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).