C10H10N4 — CID 175842064
6-(ethylamino)pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 175842064) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 6-(ethylamino)pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-(ethylamino)pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 175842064 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 6-(ethylamino)pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | CCNc1ccc2c(C#N)cnn2c1 |
| InChI | InChI=1S/C10H10N4/c1-2-12-9-3-4-10-8(5-11)6-13-14(10)7-9/h3-4,6-7,12H,2H2,1H3 |
| InChIKey | ZCRRTCUYASRBKI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |