C5H9BrF2 — CID 84660821
4-bromo-1,1-difluoro-2-methylbutane (PubChem CID 84660821) has the molecular formula C5H9BrF2 and a molecular weight of 187.03 g/mol. Its IUPAC name is 4-bromo-1,1-difluoro-2-methylbutane.
| Compound Name | 4-bromo-1,1-difluoro-2-methylbutane |
|---|---|
| PubChem CID | 84660821 |
| Molecular Formula | C5H9BrF2 |
| Molecular Weight | 187.03 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | 4-bromo-1,1-difluoro-2-methylbutane |
| SMILES | CC(CCBr)C(F)F |
| InChI | InChI=1S/C5H9BrF2/c1-4(2-3-6)5(7)8/h4-5H,2-3H2,1H3 |
| InChIKey | AIWDMDQXJKVBDF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.03 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|