C9H14F2N2 — CID 84661423
3-[1-(2,2-difluoroethyl)pyrrol-3-yl]propan-1-amine (PubChem CID 84661423) has the molecular formula C9H14F2N2 and a molecular weight of 188.22 g/mol. Its IUPAC name is 3-[1-(2,2-difluoroethyl)pyrrol-3-yl]propan-1-amine.
| Compound Name | 3-[1-(2,2-difluoroethyl)pyrrol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 84661423 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 3-[1-(2,2-difluoroethyl)pyrrol-3-yl]propan-1-amine |
| SMILES | NCCCc1ccn(CC(F)F)c1 |
| InChI | InChI=1S/C9H14F2N2/c10-9(11)7-13-5-3-8(6-13)2-1-4-12/h3,5-6,9H,1-2,4,7,12H2 |
| InChIKey | MWOUJEPCCHWMMQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |