C13H15FN2 — CID 66404826
2-[1-[(3-fluorophenyl)methyl]pyrrol-3-yl]ethanamine (PubChem CID 66404826) has the molecular formula C13H15FN2 and a molecular weight of 218.27 g/mol. Its IUPAC name is 2-[1-[(3-fluorophenyl)methyl]pyrrol-3-yl]ethanamine.
| Compound Name | 2-[1-[(3-fluorophenyl)methyl]pyrrol-3-yl]ethanamine |
|---|---|
| PubChem CID | 66404826 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-[1-[(3-fluorophenyl)methyl]pyrrol-3-yl]ethanamine |
| SMILES | NCCc1ccn(Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C13H15FN2/c14-13-3-1-2-12(8-13)10-16-7-5-11(9-16)4-6-15/h1-3,5,7-9H,4,6,10,15H2 |
| InChIKey | DVSVZJWTAJBEBS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |