C10H12N4 — CID 84661549
[2-methyl-5-(1,2,4-triazol-4-yl)phenyl]methanamine (PubChem CID 84661549) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is [2-methyl-5-(1,2,4-triazol-4-yl)phenyl]methanamine.
| Compound Name | [2-methyl-5-(1,2,4-triazol-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 84661549 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | [2-methyl-5-(1,2,4-triazol-4-yl)phenyl]methanamine |
| SMILES | Cc1ccc(-n2cnnc2)cc1CN |
| InChI | InChI=1S/C10H12N4/c1-8-2-3-10(4-9(8)5-11)14-6-12-13-7-14/h2-4,6-7H,5,11H2,1H3 |
| InChIKey | GTSQBJAYJJZHGR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |