C8H9ClO3 — CID 84661730
3-chloro-2,5-dimethoxyphenol (PubChem CID 84661730) has the molecular formula C8H9ClO3 and a molecular weight of 188.61 g/mol. Its IUPAC name is 3-chloro-2,5-dimethoxyphenol.
| Compound Name | 3-chloro-2,5-dimethoxyphenol |
|---|---|
| PubChem CID | 84661730 |
| Molecular Formula | C8H9ClO3 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 3-chloro-2,5-dimethoxyphenol |
| SMILES | COc1cc(O)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C8H9ClO3/c1-11-5-3-6(9)8(12-2)7(10)4-5/h3-4,10H,1-2H3 |
| InChIKey | HCTBWBGIEFPOBU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |