C10H10N2O2 — CID 84662527
3-[(3-aminophenyl)methyl]-2H-1,2-oxazol-5-one (PubChem CID 84662527) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-[(3-aminophenyl)methyl]-2H-1,2-oxazol-5-one.
| Compound Name | 3-[(3-aminophenyl)methyl]-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 84662527 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-[(3-aminophenyl)methyl]-2H-1,2-oxazol-5-one |
| SMILES | Nc1cccc(Cc2cc(=O)o[nH]2)c1 |
| InChI | InChI=1S/C10H10N2O2/c11-8-3-1-2-7(4-8)5-9-6-10(13)14-12-9/h1-4,6,12H,5,11H2 |
| InChIKey | NCVOJKRVGLPDRN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|