About (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine
(3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine (PubChem CID 84663398) has the molecular formula C9H13N5
and a molecular weight of 191.24 g/mol. Its IUPAC name is (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine.
Analyze (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine?
The IUPAC name of (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine (CID 84663398) is (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine.
What is the SMILES notation for (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine?
The canonical SMILES for (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine is CC(C)n1nnc2c(CN)ccnc21.
What is the InChIKey of (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine?
The InChIKey is YXEYRMBSBHWVQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5/c1-6(2)14-9-8(12-13-14)7(5-10)3-4-11-9/h3-4,6H,5,10H2,1-2H3.
What are the key properties of (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine?
(3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine has a molecular weight of 191.24 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-propan-2-yltriazolo[4,5-b]pyridin-7-yl)methanamine is sourced from PubChem (CID 84663398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).