About 5-(difluoromethyl)-2,3-difluorobenzaldehyde
5-(difluoromethyl)-2,3-difluorobenzaldehyde (PubChem CID 84663702) has the molecular formula C8H4F4O
and a molecular weight of 192.11 g/mol. Its IUPAC name is 5-(difluoromethyl)-2,3-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-2,3-difluorobenzaldehyde |
| PubChem CID | 84663702 |
| Molecular Formula | C8H4F4O |
| Molecular Weight | 192.11 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 5-(difluoromethyl)-2,3-difluorobenzaldehyde |
| SMILES | O=Cc1cc(C(F)F)cc(F)c1F |
| InChI | InChI=1S/C8H4F4O/c9-6-2-4(8(11)12)1-5(3-13)7(6)10/h1-3,8H |
| InChIKey | GWCANHTVUJJJIN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.11 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(difluoromethyl)-2,3-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-2,3-difluorobenzaldehyde?
The IUPAC name of 5-(difluoromethyl)-2,3-difluorobenzaldehyde (CID 84663702) is 5-(difluoromethyl)-2,3-difluorobenzaldehyde.
What is the SMILES notation for 5-(difluoromethyl)-2,3-difluorobenzaldehyde?
The canonical SMILES for 5-(difluoromethyl)-2,3-difluorobenzaldehyde is O=Cc1cc(C(F)F)cc(F)c1F.
What is the InChIKey of 5-(difluoromethyl)-2,3-difluorobenzaldehyde?
The InChIKey is GWCANHTVUJJJIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F4O/c9-6-2-4(8(11)12)1-5(3-13)7(6)10/h1-3,8H.
What are the key properties of 5-(difluoromethyl)-2,3-difluorobenzaldehyde?
5-(difluoromethyl)-2,3-difluorobenzaldehyde has a molecular weight of 192.11 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-2,3-difluorobenzaldehyde is sourced from PubChem (CID 84663702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).