About 3-methylbenzaldehyde
3-methylbenzaldehyde (PubChem CID 12105) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3-methylbenzaldehyde.
Molecular Properties
| Compound Name | 3-methylbenzaldehyde |
| PubChem CID | 12105 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | 3-methylbenzaldehyde |
| SMILES | Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C8H8O/c1-7-3-2-4-8(5-7)6-9/h2-6H,1H3 |
| InChIKey | OVWYEQOVUDKZNU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzaldehyde?
The IUPAC name of 3-methylbenzaldehyde (CID 12105) is 3-methylbenzaldehyde.
What is the SMILES notation for 3-methylbenzaldehyde?
The canonical SMILES for 3-methylbenzaldehyde is Cc1cccc(C=O)c1.
What is the InChIKey of 3-methylbenzaldehyde?
The InChIKey is OVWYEQOVUDKZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-7-3-2-4-8(5-7)6-9/h2-6H,1H3.
What are the key properties of 3-methylbenzaldehyde?
3-methylbenzaldehyde has a molecular weight of 120.15 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzaldehyde is sourced from PubChem (CID 12105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).