C10H11NO3 — CID 84664570
methyl 7-hydroxy-2,3-dihydro-1H-indole-4-carboxylate (PubChem CID 84664570) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is methyl 7-hydroxy-2,3-dihydro-1H-indole-4-carboxylate.
| Compound Name | methyl 7-hydroxy-2,3-dihydro-1H-indole-4-carboxylate |
|---|---|
| PubChem CID | 84664570 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | methyl 7-hydroxy-2,3-dihydro-1H-indole-4-carboxylate |
| SMILES | COC(=O)c1ccc(O)c2c1CCN2 |
| InChI | InChI=1S/C10H11NO3/c1-14-10(13)7-2-3-8(12)9-6(7)4-5-11-9/h2-3,11-12H,4-5H2,1H3 |
| InChIKey | JZNBIAVGXWMRPF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|