C10H15N3O — CID 84664929
5-methyl-2-piperidin-4-yl-1H-pyrimidin-6-one (PubChem CID 84664929) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-methyl-2-piperidin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 5-methyl-2-piperidin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 84664929 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 5-methyl-2-piperidin-4-yl-1H-pyrimidin-6-one |
| SMILES | Cc1cnc(C2CCNCC2)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O/c1-7-6-12-9(13-10(7)14)8-2-4-11-5-3-8/h6,8,11H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | JBFNIODUMDAYBD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |