C11H9N3O — CID 84668770
1-(3H-imidazo[1,2-a]benzimidazol-2-yl)ethanone (PubChem CID 84668770) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-(3H-imidazo[1,2-a]benzimidazol-2-yl)ethanone.
| Compound Name | 1-(3H-imidazo[1,2-a]benzimidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 84668770 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1-(3H-imidazo[1,2-a]benzimidazol-2-yl)ethanone |
| SMILES | CC(=O)c1cn2c(nc3ccccc32)[nH]1 |
| InChI | InChI=1S/C11H9N3O/c1-7(15)9-6-14-10-5-3-2-4-8(10)12-11(14)13-9/h2-6H,1H3,(H,12,13) |
| InChIKey | QMLPRBHKAYXHPY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |