About 2-phenyl-3H-imidazo[1,2-a]benzimidazole
2-phenyl-3H-imidazo[1,2-a]benzimidazole (PubChem CID 854077) has the molecular formula C15H11N3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-phenyl-3H-imidazo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 2-phenyl-3H-imidazo[1,2-a]benzimidazole |
| PubChem CID | 854077 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 2-phenyl-3H-imidazo[1,2-a]benzimidazole |
| SMILES | c1ccc(-c2cn3c(nc4ccccc43)[nH]2)cc1 |
| InChI | InChI=1S/C15H11N3/c1-2-6-11(7-3-1)13-10-18-14-9-5-4-8-12(14)16-15(18)17-13/h1-10H,(H,16,17) |
| InChIKey | LOYLEFYQOSIFBB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-3H-imidazo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3H-imidazo[1,2-a]benzimidazole?
The IUPAC name of 2-phenyl-3H-imidazo[1,2-a]benzimidazole (CID 854077) is 2-phenyl-3H-imidazo[1,2-a]benzimidazole.
What is the SMILES notation for 2-phenyl-3H-imidazo[1,2-a]benzimidazole?
The canonical SMILES for 2-phenyl-3H-imidazo[1,2-a]benzimidazole is c1ccc(-c2cn3c(nc4ccccc43)[nH]2)cc1.
What is the InChIKey of 2-phenyl-3H-imidazo[1,2-a]benzimidazole?
The InChIKey is LOYLEFYQOSIFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3/c1-2-6-11(7-3-1)13-10-18-14-9-5-4-8-12(14)16-15(18)17-13/h1-10H,(H,16,17).
What are the key properties of 2-phenyl-3H-imidazo[1,2-a]benzimidazole?
2-phenyl-3H-imidazo[1,2-a]benzimidazole has a molecular weight of 233.27 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3H-imidazo[1,2-a]benzimidazole is sourced from PubChem (CID 854077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).