C25H21N3 — CID 3561010
2-(4-ethylphenyl)-5,6-diphenyl-1H-imidazo[1,2-a]imidazole (PubChem CID 3561010) has the molecular formula C25H21N3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-5,6-diphenyl-1H-imidazo[1,2-a]imidazole.
| Compound Name | 2-(4-ethylphenyl)-5,6-diphenyl-1H-imidazo[1,2-a]imidazole |
|---|---|
| PubChem CID | 3561010 |
| Molecular Formula | C25H21N3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-(4-ethylphenyl)-5,6-diphenyl-1H-imidazo[1,2-a]imidazole |
| SMILES | CCc1ccc(-c2cn3c(-c4ccccc4)c(-c4ccccc4)nc3[nH]2)cc1 |
| InChI | InChI=1S/C25H21N3/c1-2-18-13-15-19(16-14-18)22-17-28-24(21-11-7-4-8-12-21)23(27-25(28)26-22)20-9-5-3-6-10-20/h3-17H,2H2,1H3,(H,26,27) |
| InChIKey | AZFRNKBUBNFNRH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |