C7H5ClN2OS — CID 84669715
5-amino-2-chloro-7H-thieno[2,3-b]pyridin-4-one (PubChem CID 84669715) has the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. Its IUPAC name is 5-amino-2-chloro-7H-thieno[2,3-b]pyridin-4-one.
| Compound Name | 5-amino-2-chloro-7H-thieno[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 84669715 |
| Molecular Formula | C7H5ClN2OS |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 5-amino-2-chloro-7H-thieno[2,3-b]pyridin-4-one |
| SMILES | Nc1c[nH]c2sc(Cl)cc2c1=O |
| InChI | InChI=1S/C7H5ClN2OS/c8-5-1-3-6(11)4(9)2-10-7(3)12-5/h1-2H,9H2,(H,10,11) |
| InChIKey | RUCKTYWVRUROEK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |