C11H12N2S — CID 84672623
2-pyrrolidin-2-ylthieno[2,3-c]pyridine (PubChem CID 84672623) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 2-pyrrolidin-2-ylthieno[2,3-c]pyridine.
| Compound Name | 2-pyrrolidin-2-ylthieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 84672623 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-pyrrolidin-2-ylthieno[2,3-c]pyridine |
| SMILES | c1cc2cc(C3CCCN3)sc2cn1 |
| InChI | InChI=1S/C11H12N2S/c1-2-9(13-4-1)10-6-8-3-5-12-7-11(8)14-10/h3,5-7,9,13H,1-2,4H2 |
| InChIKey | WMQSWJPVPYAFCN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |