C8H9Br2NS — CID 131001434
(2R)-2-(4,5-dibromothiophen-2-yl)pyrrolidine (PubChem CID 131001434) has the molecular formula C8H9Br2NS and a molecular weight of 311.04 g/mol. Its IUPAC name is (2R)-2-(4,5-dibromothiophen-2-yl)pyrrolidine.
| Compound Name | (2R)-2-(4,5-dibromothiophen-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 131001434 |
| Molecular Formula | C8H9Br2NS |
| Molecular Weight | 311.04 g/mol |
| Exact Mass | 308.88 |
| IUPAC Name | (2R)-2-(4,5-dibromothiophen-2-yl)pyrrolidine |
| SMILES | Brc1cc([C@H]2CCCN2)sc1Br |
| InChI | InChI=1S/C8H9Br2NS/c9-5-4-7(12-8(5)10)6-2-1-3-11-6/h4,6,11H,1-3H2/t6-/m1/s1 |
| InChIKey | SZJUGWVNSNTABO-ZCFIWIBFSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.04 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |