C10H13Br2NS — CID 107959791
2-(2,5-dibromothiophen-3-yl)azepane (PubChem CID 107959791) has the molecular formula C10H13Br2NS and a molecular weight of 339.10 g/mol. Its IUPAC name is 2-(2,5-dibromothiophen-3-yl)azepane.
| Compound Name | 2-(2,5-dibromothiophen-3-yl)azepane |
|---|---|
| PubChem CID | 107959791 |
| Molecular Formula | C10H13Br2NS |
| Molecular Weight | 339.10 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | 2-(2,5-dibromothiophen-3-yl)azepane |
| SMILES | Brc1cc(C2CCCCCN2)c(Br)s1 |
| InChI | InChI=1S/C10H13Br2NS/c11-9-6-7(10(12)14-9)8-4-2-1-3-5-13-8/h6,8,13H,1-5H2 |
| InChIKey | HRPFFCCXVWNEEZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.10 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |