C10H17F2NO — CID 84673159
1-(3,3-difluoropropyl)azepane-3-carbaldehyde (PubChem CID 84673159) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is 1-(3,3-difluoropropyl)azepane-3-carbaldehyde.
| Compound Name | 1-(3,3-difluoropropyl)azepane-3-carbaldehyde |
|---|---|
| PubChem CID | 84673159 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-(3,3-difluoropropyl)azepane-3-carbaldehyde |
| SMILES | O=CC1CCCCN(CCC(F)F)C1 |
| InChI | InChI=1S/C10H17F2NO/c11-10(12)4-6-13-5-2-1-3-9(7-13)8-14/h8-10H,1-7H2 |
| InChIKey | PRGWSGOCKVWKMZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|