C11H19F2NO — CID 84684722
2-[1-(3,3-difluoropropyl)azepan-4-yl]acetaldehyde (PubChem CID 84684722) has the molecular formula C11H19F2NO and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-[1-(3,3-difluoropropyl)azepan-4-yl]acetaldehyde.
| Compound Name | 2-[1-(3,3-difluoropropyl)azepan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 84684722 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-[1-(3,3-difluoropropyl)azepan-4-yl]acetaldehyde |
| SMILES | O=CCC1CCCN(CCC(F)F)CC1 |
| InChI | InChI=1S/C11H19F2NO/c12-11(13)4-8-14-6-1-2-10(3-7-14)5-9-15/h9-11H,1-8H2 |
| InChIKey | CQERSNJVEGKGPF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|