About 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid
6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid (PubChem CID 84675953) has the molecular formula C12H13FO2
and a molecular weight of 208.23 g/mol. Its IUPAC name is 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid.
Analyze 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid?
The IUPAC name of 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid (CID 84675953) is 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid.
What is the SMILES notation for 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid?
The canonical SMILES for 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid is CC1(F)CCc2cc(C(=O)O)ccc2C1.
What is the InChIKey of 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid?
The InChIKey is LNRFCLJKPRRBTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO2/c1-12(13)5-4-8-6-9(11(14)15)2-3-10(8)7-12/h2-3,6H,4-5,7H2,1H3,(H,14,15).
What are the key properties of 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid?
6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid has a molecular weight of 208.23 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-6-methyl-7,8-dihydro-5H-naphthalene-2-carboxylic acid is sourced from PubChem (CID 84675953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).