C12H11KNO3- — CID 59027888
potassium (5-carboxy-2-methanidyl-1,3-dihydroindene-2-carbonyl)azanide (PubChem CID 59027888) has the molecular formula C12H11KNO3- and a molecular weight of 256.32 g/mol. Its IUPAC name is potassium (5-carboxy-2-methanidyl-1,3-dihydroindene-2-carbonyl)azanide.
| Compound Name | potassium (5-carboxy-2-methanidyl-1,3-dihydroindene-2-carbonyl)azanide |
|---|---|
| PubChem CID | 59027888 |
| Molecular Formula | C12H11KNO3- |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | potassium (5-carboxy-2-methanidyl-1,3-dihydroindene-2-carbonyl)azanide |
| SMILES | [CH2-]C1(C([NH-])=O)Cc2ccc(C(=O)O)cc2C1.[K+] |
| InChI | InChI=1S/C12H12NO3.K/c1-12(11(13)16)5-8-3-2-7(10(14)15)4-9(8)6-12;/h2-4H,1,5-6H2,(H3,13,14,15,16);/q-1;+1/p-1 |
| InChIKey | CQGQYTNJGQZXGH-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|