C9H9ClN4 — CID 84676485
2-(5-chloro-2-methyl-1,2,4-triazol-3-yl)aniline (PubChem CID 84676485) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 2-(5-chloro-2-methyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 84676485 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-(5-chloro-2-methyl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cn1nc(Cl)nc1-c1ccccc1N |
| InChI | InChI=1S/C9H9ClN4/c1-14-8(12-9(10)13-14)6-4-2-3-5-7(6)11/h2-5H,11H2,1H3 |
| InChIKey | HSLMSFJLTMDZOQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|